C16H21S+ — CID 147153536
methyl-phenyl-(3-tricyclo[3.3.1.03,7]nonanyl)sulfanium (PubChem CID 147153536) has the molecular formula C16H21S+ and a molecular weight of 245.41 g/mol. Its IUPAC name is methyl-phenyl-(3-tricyclo[3.3.1.03,7]nonanyl)sulfanium.
| Compound Name | methyl-phenyl-(3-tricyclo[3.3.1.03,7]nonanyl)sulfanium |
|---|---|
| PubChem CID | 147153536 |
| Molecular Formula | C16H21S+ |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | methyl-phenyl-(3-tricyclo[3.3.1.03,7]nonanyl)sulfanium |
| SMILES | C[S+](c1ccccc1)C12CC3CC(CC1C3)C2 |
| InChI | InChI=1S/C16H21S/c1-17(15-5-3-2-4-6-15)16-10-12-7-13(11-16)9-14(16)8-12/h2-6,12-14H,7-11H2,1H3/q+1 |
| InChIKey | BULGQTPESVRBAB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|