C52H66FeN2P2 — CID 159117950
bis(1-adamantyl)-[[4,5-diphenyl-2-[phosphanyl-di(pyrrolidin-2-yl)methyl]cyclopenta-1,3-dien-1-yl]methyl]phosphane;cyclopenta-1,3-diene;iron(2+) (PubChem CID 159117950) has the molecular formula C52H66FeN2P2 and a molecular weight of 836.91 g/mol. Its IUPAC name is bis(1-adamantyl)-[[4,5-diphenyl-2-[phosphanyl-di(pyrrolidin-2-yl)methyl]cyclopenta-1,3-dien-1-yl]methyl]phosphane;cyclopenta-1,3-diene;iron(2+).
| Compound Name | bis(1-adamantyl)-[[4,5-diphenyl-2-[phosphanyl-di(pyrrolidin-2-yl)methyl]cyclopenta-1,3-dien-1-yl]methyl]phosphane;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 159117950 |
| Molecular Formula | C52H66FeN2P2 |
| Molecular Weight | 836.91 g/mol |
| Exact Mass | 836.41 |
| IUPAC Name | bis(1-adamantyl)-[[4,5-diphenyl-2-[phosphanyl-di(pyrrolidin-2-yl)methyl]cyclopenta-1,3-dien-1-yl]methyl]phosphane;cyclopenta-1,3-diene;iron(2+) |
| SMILES | PC(c1cc(-c2ccccc2)[c-](-c2ccccc2)c1CP(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2)(C1CCCN1)C1CCCN1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C47H61N2P2.C5H5.Fe/c50-47(42-13-7-15-48-42,43-14-8-16-49-43)41-23-39(37-9-3-1-4-10-37)44(38-11-5-2-6-12-38)40(41)30-51(45-24-31-17-32(25-45)19-33(18-31)26-45)46-27-34-20-35(28-46)22-36(21-34)29-46;1-2-4-5-3-1;/h1-6,9-12,23,31-36,42-43,48-49H,7-8,13-22,24-30,50H2;1-5H;/q2*-1;+2 |
| InChIKey | KFHYESZOEANBLK-UHFFFAOYSA-N |
| XLogP | 12.64 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.91 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|