C35H46P2Si — CID 87241751
bis(2-methylphenyl)-[[2-[2-(phosphanylmethyl)-2-adamantyl]-5-trimethylsilylphenyl]methyl]phosphane (PubChem CID 87241751) has the molecular formula C35H46P2Si and a molecular weight of 556.79 g/mol. Its IUPAC name is bis(2-methylphenyl)-[[2-[2-(phosphanylmethyl)-2-adamantyl]-5-trimethylsilylphenyl]methyl]phosphane.
| Compound Name | bis(2-methylphenyl)-[[2-[2-(phosphanylmethyl)-2-adamantyl]-5-trimethylsilylphenyl]methyl]phosphane |
|---|---|
| PubChem CID | 87241751 |
| Molecular Formula | C35H46P2Si |
| Molecular Weight | 556.79 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | bis(2-methylphenyl)-[[2-[2-(phosphanylmethyl)-2-adamantyl]-5-trimethylsilylphenyl]methyl]phosphane |
| SMILES | Cc1ccccc1P(Cc1cc([Si](C)(C)C)ccc1C1(CP)C2CC3CC(C2)CC1C3)c1ccccc1C |
| InChI | InChI=1S/C35H46P2Si/c1-24-10-6-8-12-33(24)37(34-13-9-7-11-25(34)2)22-28-21-31(38(3,4)5)14-15-32(28)35(23-36)29-17-26-16-27(19-29)20-30(35)18-26/h6-15,21,26-27,29-30H,16-20,22-23,36H2,1-5H3 |
| InChIKey | VPGDJUOCXAPADJ-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.79 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|