C33H48N2P2Si2 — CID 176525869
[5-[2-(phosphanylmethyl)-2-adamantyl]-3,4-bis(trimethylsilyl)cyclopenta-1,4-dien-1-yl]methyl-dipyridin-2-ylphosphane (PubChem CID 176525869) has the molecular formula C33H48N2P2Si2 and a molecular weight of 590.88 g/mol. Its IUPAC name is [5-[2-(phosphanylmethyl)-2-adamantyl]-3,4-bis(trimethylsilyl)cyclopenta-1,4-dien-1-yl]methyl-dipyridin-2-ylphosphane.
| Compound Name | [5-[2-(phosphanylmethyl)-2-adamantyl]-3,4-bis(trimethylsilyl)cyclopenta-1,4-dien-1-yl]methyl-dipyridin-2-ylphosphane |
|---|---|
| PubChem CID | 176525869 |
| Molecular Formula | C33H48N2P2Si2 |
| Molecular Weight | 590.88 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | [5-[2-(phosphanylmethyl)-2-adamantyl]-3,4-bis(trimethylsilyl)cyclopenta-1,4-dien-1-yl]methyl-dipyridin-2-ylphosphane |
| SMILES | C[Si](C)(C)C1=C(C2(CP)C3CC4CC(C3)CC2C4)C(CP(c2ccccn2)c2ccccn2)=CC1[Si](C)(C)C |
| InChI | InChI=1S/C33H48N2P2Si2/c1-38(2,3)28-20-25(21-37(29-11-7-9-13-34-29)30-12-8-10-14-35-30)31(32(28)39(4,5)6)33(22-36)26-16-23-15-24(18-26)19-27(33)17-23/h7-14,20,23-24,26-28H,15-19,21-22,36H2,1-6H3 |
| InChIKey | KPLKMXUBMCFRGW-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.88 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|