C46H52N2P2 — CID 87343471
[4,5-bis(2-phenylpropan-2-yl)-2-[2-(phosphanylmethyl)-1-adamantyl]phenyl]methyl-dipyridin-2-ylphosphane (PubChem CID 87343471) has the molecular formula C46H52N2P2 and a molecular weight of 694.88 g/mol. Its IUPAC name is [4,5-bis(2-phenylpropan-2-yl)-2-[2-(phosphanylmethyl)-1-adamantyl]phenyl]methyl-dipyridin-2-ylphosphane.
| Compound Name | [4,5-bis(2-phenylpropan-2-yl)-2-[2-(phosphanylmethyl)-1-adamantyl]phenyl]methyl-dipyridin-2-ylphosphane |
|---|---|
| PubChem CID | 87343471 |
| Molecular Formula | C46H52N2P2 |
| Molecular Weight | 694.88 g/mol |
| Exact Mass | 694.36 |
| IUPAC Name | [4,5-bis(2-phenylpropan-2-yl)-2-[2-(phosphanylmethyl)-1-adamantyl]phenyl]methyl-dipyridin-2-ylphosphane |
| SMILES | CC(C)(c1ccccc1)c1cc(CP(c2ccccn2)c2ccccn2)c(C23CC4CC(CC(C4)C2CP)C3)cc1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C46H52N2P2/c1-44(2,36-15-7-5-8-16-36)39-26-35(31-50(42-19-11-13-21-47-42)43-20-12-14-22-48-43)38(27-40(39)45(3,4)37-17-9-6-10-18-37)46-28-32-23-33(29-46)25-34(24-32)41(46)30-49/h5-22,26-27,32-34,41H,23-25,28-31,49H2,1-4H3 |
| InChIKey | FYTHEPHNSGDWTE-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.88 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|