C32H40N2P2 — CID 87343545
[1-[4-tert-butyl-2-[phosphanyl(dipyridin-2-yl)methyl]phenyl]-2-adamantyl]methylphosphane (PubChem CID 87343545) has the molecular formula C32H40N2P2 and a molecular weight of 514.63 g/mol. Its IUPAC name is [1-[4-tert-butyl-2-[phosphanyl(dipyridin-2-yl)methyl]phenyl]-2-adamantyl]methylphosphane.
| Compound Name | [1-[4-tert-butyl-2-[phosphanyl(dipyridin-2-yl)methyl]phenyl]-2-adamantyl]methylphosphane |
|---|---|
| PubChem CID | 87343545 |
| Molecular Formula | C32H40N2P2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | [1-[4-tert-butyl-2-[phosphanyl(dipyridin-2-yl)methyl]phenyl]-2-adamantyl]methylphosphane |
| SMILES | CC(C)(C)c1ccc(C23CC4CC(CC(C4)C2CP)C3)c(C(P)(c2ccccn2)c2ccccn2)c1 |
| InChI | InChI=1S/C32H40N2P2/c1-30(2,3)24-10-11-25(31-18-21-14-22(19-31)16-23(15-21)27(31)20-35)26(17-24)32(36,28-8-4-6-12-33-28)29-9-5-7-13-34-29/h4-13,17,21-23,27H,14-16,18-20,35-36H2,1-3H3 |
| InChIKey | JTZGVISCJAEKEV-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|