C36H52FeN2P2Si2 — CID 158924895
cyclopenta-1,3-diene;iron(2+);[1-[2-[phosphanyl-bis(1H-pyrrol-3-yl)methyl]-4,5-bis(trimethylsilyl)cyclopenta-1,3-dien-1-yl]-2-adamantyl]methylphosphane (PubChem CID 158924895) has the molecular formula C36H52FeN2P2Si2 and a molecular weight of 686.79 g/mol. Its IUPAC name is cyclopenta-1,3-diene;iron(2+);[1-[2-[phosphanyl-bis(1H-pyrrol-3-yl)methyl]-4,5-bis(trimethylsilyl)cyclopenta-1,3-dien-1-yl]-2-adamantyl]methylphosphane.
| Compound Name | cyclopenta-1,3-diene;iron(2+);[1-[2-[phosphanyl-bis(1H-pyrrol-3-yl)methyl]-4,5-bis(trimethylsilyl)cyclopenta-1,3-dien-1-yl]-2-adamantyl]methylphosphane |
|---|---|
| PubChem CID | 158924895 |
| Molecular Formula | C36H52FeN2P2Si2 |
| Molecular Weight | 686.79 g/mol |
| Exact Mass | 686.25 |
| IUPAC Name | cyclopenta-1,3-diene;iron(2+);[1-[2-[phosphanyl-bis(1H-pyrrol-3-yl)methyl]-4,5-bis(trimethylsilyl)cyclopenta-1,3-dien-1-yl]-2-adamantyl]methylphosphane |
| SMILES | C[Si](C)(C)c1cc(C(P)(c2cc[nH]c2)c2cc[nH]c2)c(C23CC4CC(CC(C4)C2CP)C3)[c-]1[Si](C)(C)C.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C31H47N2P2Si2.C5H5.Fe/c1-36(2,3)27-14-25(31(35,23-7-9-32-17-23)24-8-10-33-18-24)28(29(27)37(4,5)6)30-15-20-11-21(16-30)13-22(12-20)26(30)19-34;1-2-4-5-3-1;/h7-10,14,17-18,20-22,26,32-33H,11-13,15-16,19,34-35H2,1-6H3;1-5H;/q2*-1;+2 |
| InChIKey | JIHSCCBWTNWDLB-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.79 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|