C38H52FeN2P2 — CID 162049847
[1-[3-cyclohexa-2,4-dien-1-ylidene-5-[phosphanyl-di(piperidin-3-yl)methyl]cyclopenta-1,4-dien-1-yl]-2-adamantyl]methylphosphane;cyclopenta-1,3-diene;iron(2+) (PubChem CID 162049847) has the molecular formula C38H52FeN2P2 and a molecular weight of 654.64 g/mol. Its IUPAC name is [1-[3-cyclohexa-2,4-dien-1-ylidene-5-[phosphanyl-di(piperidin-3-yl)methyl]cyclopenta-1,4-dien-1-yl]-2-adamantyl]methylphosphane;cyclopenta-1,3-diene;iron(2+).
| Compound Name | [1-[3-cyclohexa-2,4-dien-1-ylidene-5-[phosphanyl-di(piperidin-3-yl)methyl]cyclopenta-1,4-dien-1-yl]-2-adamantyl]methylphosphane;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 162049847 |
| Molecular Formula | C38H52FeN2P2 |
| Molecular Weight | 654.64 g/mol |
| Exact Mass | 654.30 |
| IUPAC Name | [1-[3-cyclohexa-2,4-dien-1-ylidene-5-[phosphanyl-di(piperidin-3-yl)methyl]cyclopenta-1,4-dien-1-yl]-2-adamantyl]methylphosphane;cyclopenta-1,3-diene;iron(2+) |
| SMILES | PCC1C2CC3CC(C2)CC1(C1=CC(=C2C=CC=C[CH-]2)C=C1C(P)(C1CCCNC1)C1CCCNC1)C3.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C33H47N2P2.C5H5.Fe/c36-21-31-26-13-22-12-23(14-26)18-32(31,17-22)29-15-25(24-6-2-1-3-7-24)16-30(29)33(37,27-8-4-10-34-19-27)28-9-5-11-35-20-28;1-2-4-5-3-1;/h1-3,6-7,15-16,22-23,26-28,31,34-35H,4-5,8-14,17-21,36-37H2;1-5H;/q2*-1;+2 |
| InChIKey | YYKCRTKYVUOGPR-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.64 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|