C28H35F3 — CID 10598645
1-[1-adamantyl-[3-(trifluoromethyl)phenyl]methyl]adamantane (PubChem CID 10598645) has the molecular formula C28H35F3 and a molecular weight of 428.58 g/mol. Its IUPAC name is 1-[1-adamantyl-[3-(trifluoromethyl)phenyl]methyl]adamantane.
| Compound Name | 1-[1-adamantyl-[3-(trifluoromethyl)phenyl]methyl]adamantane |
|---|---|
| PubChem CID | 10598645 |
| Molecular Formula | C28H35F3 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 1-[1-adamantyl-[3-(trifluoromethyl)phenyl]methyl]adamantane |
| SMILES | FC(F)(F)c1cccc(C(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C28H35F3/c29-28(30,31)24-3-1-2-23(10-24)25(26-11-17-4-18(12-26)6-19(5-17)13-26)27-14-20-7-21(15-27)9-22(8-20)16-27/h1-3,10,17-22,25H,4-9,11-16H2 |
| InChIKey | XMEMYUGQEYELTP-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |