C21H22F3N — CID 141223568
(2S)-2-[(S)-phenyl-[3-(trifluoromethyl)phenyl]methyl]-1-azabicyclo[2.2.2]octane (PubChem CID 141223568) has the molecular formula C21H22F3N and a molecular weight of 345.41 g/mol. Its IUPAC name is (2S)-2-[(S)-phenyl-[3-(trifluoromethyl)phenyl]methyl]-1-azabicyclo[2.2.2]octane.
| Compound Name | (2S)-2-[(S)-phenyl-[3-(trifluoromethyl)phenyl]methyl]-1-azabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 141223568 |
| Molecular Formula | C21H22F3N |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (2S)-2-[(S)-phenyl-[3-(trifluoromethyl)phenyl]methyl]-1-azabicyclo[2.2.2]octane |
| SMILES | FC(F)(F)c1cccc([C@H](c2ccccc2)[C@@H]2CC3CCN2CC3)c1 |
| InChI | InChI=1S/C21H22F3N/c22-21(23,24)18-8-4-7-17(14-18)20(16-5-2-1-3-6-16)19-13-15-9-11-25(19)12-10-15/h1-8,14-15,19-20H,9-13H2/t19-,20-/m0/s1 |
| InChIKey | UWFXWXKLWOVVJB-PMACEKPBSA-N |
| XLogP | 5.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |