C37H40N2P2 — CID 158941198
[1-[4,5-diphenyl-2-[phosphanyl-bis(1H-pyrrol-3-yl)methyl]cyclopenta-1,3-dien-1-yl]-2-adamantyl]methylphosphane (PubChem CID 158941198) has the molecular formula C37H40N2P2 and a molecular weight of 574.69 g/mol. Its IUPAC name is [1-[4,5-diphenyl-2-[phosphanyl-bis(1H-pyrrol-3-yl)methyl]cyclopenta-1,3-dien-1-yl]-2-adamantyl]methylphosphane.
| Compound Name | [1-[4,5-diphenyl-2-[phosphanyl-bis(1H-pyrrol-3-yl)methyl]cyclopenta-1,3-dien-1-yl]-2-adamantyl]methylphosphane |
|---|---|
| PubChem CID | 158941198 |
| Molecular Formula | C37H40N2P2 |
| Molecular Weight | 574.69 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | [1-[4,5-diphenyl-2-[phosphanyl-bis(1H-pyrrol-3-yl)methyl]cyclopenta-1,3-dien-1-yl]-2-adamantyl]methylphosphane |
| SMILES | PCC1C2CC3CC(C2)CC1(C1=C(C(P)(c2cc[nH]c2)c2cc[nH]c2)C=C(c2ccccc2)C1c1ccccc1)C3 |
| InChI | InChI=1S/C37H40N2P2/c40-23-33-28-16-24-15-25(17-28)20-36(33,19-24)35-32(37(41,29-11-13-38-21-29)30-12-14-39-22-30)18-31(26-7-3-1-4-8-26)34(35)27-9-5-2-6-10-27/h1-14,18,21-22,24-25,28,33-34,38-39H,15-17,19-20,23,40-41H2 |
| InChIKey | ULJUQEFIGLODRX-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.69 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|