C38H52O3P2 — CID 158842938
ditert-butyl-[[3,4-diphenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]cyclopenta-1,4-dien-1-yl]methyl]phosphane (PubChem CID 158842938) has the molecular formula C38H52O3P2 and a molecular weight of 618.78 g/mol. Its IUPAC name is ditert-butyl-[[3,4-diphenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]cyclopenta-1,4-dien-1-yl]methyl]phosphane.
| Compound Name | ditert-butyl-[[3,4-diphenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]cyclopenta-1,4-dien-1-yl]methyl]phosphane |
|---|---|
| PubChem CID | 158842938 |
| Molecular Formula | C38H52O3P2 |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.34 |
| IUPAC Name | ditert-butyl-[[3,4-diphenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]cyclopenta-1,4-dien-1-yl]methyl]phosphane |
| SMILES | CC12CC3(C)OC(C)(CC(C)(O1)C3(CP)C1=C(CP(C(C)(C)C)C(C)(C)C)C=C(c3ccccc3)C1c1ccccc1)O2 |
| InChI | InChI=1S/C38H52O3P2/c1-32(2,3)43(33(4,5)6)22-28-21-29(26-17-13-11-14-18-26)30(27-19-15-12-16-20-27)31(28)38(25-42)34(7)23-36(9)40-35(38,8)24-37(10,39-34)41-36/h11-21,30H,22-25,42H2,1-10H3 |
| InChIKey | IJAFKZAOTPVAMA-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|