C33H48O3P2 — CID 87465238
ditert-butyl-[[5-phenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]methyl]phosphane (PubChem CID 87465238) has the molecular formula C33H48O3P2 and a molecular weight of 554.69 g/mol. Its IUPAC name is ditert-butyl-[[5-phenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]methyl]phosphane.
| Compound Name | ditert-butyl-[[5-phenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]methyl]phosphane |
|---|---|
| PubChem CID | 87465238 |
| Molecular Formula | C33H48O3P2 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | ditert-butyl-[[5-phenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]methyl]phosphane |
| SMILES | CC12CC3(C)OC(C)(CC(C)(O1)C3(CP)c1ccc(-c3ccccc3)cc1CP(C(C)(C)C)C(C)(C)C)O2 |
| InChI | InChI=1S/C33H48O3P2/c1-27(2,3)38(28(4,5)6)19-25-18-24(23-14-12-11-13-15-23)16-17-26(25)33(22-37)29(7)20-31(9)35-30(33,8)21-32(10,34-29)36-31/h11-18H,19-22,37H2,1-10H3 |
| InChIKey | HBFGAXXFXLINQU-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|