C25H43P — CID 122694035
1-adamantyl-butyl-[(5R)-3-ethyl-3-bicyclo[3.3.1]nonanyl]phosphane (PubChem CID 122694035) has the molecular formula C25H43P and a molecular weight of 374.59 g/mol. Its IUPAC name is 1-adamantyl-butyl-[(5R)-3-ethyl-3-bicyclo[3.3.1]nonanyl]phosphane.
| Compound Name | 1-adamantyl-butyl-[(5R)-3-ethyl-3-bicyclo[3.3.1]nonanyl]phosphane |
|---|---|
| PubChem CID | 122694035 |
| Molecular Formula | C25H43P |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.31 |
| IUPAC Name | 1-adamantyl-butyl-[(5R)-3-ethyl-3-bicyclo[3.3.1]nonanyl]phosphane |
| SMILES | CCCCP(C12CC3CC(CC(C3)C1)C2)C1(CC)CC2CCC[C@H](C2)C1 |
| InChI | InChI=1S/C25H43P/c1-3-5-9-26(24(4-2)14-19-7-6-8-20(10-19)15-24)25-16-21-11-22(17-25)13-23(12-21)18-25/h19-23H,3-18H2,1-2H3/t19-,20?,21?,22?,23?,24?,25?,26?/m1/s1 |
| InChIKey | BKIMVQMMESPEMD-HWFZJDDESA-N |
| XLogP | 7.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|