C28H48FeN4P2 — CID 159688482
cyclopenta-1,3-diene;ditert-butyl-[[2-[phosphanyl-di(piperazin-2-yl)methyl]cyclopenta-1,4-dien-1-yl]methyl]phosphane;iron(2+) (PubChem CID 159688482) has the molecular formula C28H48FeN4P2 and a molecular weight of 558.51 g/mol. Its IUPAC name is cyclopenta-1,3-diene;ditert-butyl-[[2-[phosphanyl-di(piperazin-2-yl)methyl]cyclopenta-1,4-dien-1-yl]methyl]phosphane;iron(2+).
| Compound Name | cyclopenta-1,3-diene;ditert-butyl-[[2-[phosphanyl-di(piperazin-2-yl)methyl]cyclopenta-1,4-dien-1-yl]methyl]phosphane;iron(2+) |
|---|---|
| PubChem CID | 159688482 |
| Molecular Formula | C28H48FeN4P2 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | cyclopenta-1,3-diene;ditert-butyl-[[2-[phosphanyl-di(piperazin-2-yl)methyl]cyclopenta-1,4-dien-1-yl]methyl]phosphane;iron(2+) |
| SMILES | CC(C)(C)P(Cc1cc[cH-]c1C(P)(C1CNCCN1)C1CNCCN1)C(C)(C)C.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C23H43N4P2.C5H5.Fe/c1-21(2,3)29(22(4,5)6)16-17-8-7-9-18(17)23(28,19-14-24-10-12-26-19)20-15-25-11-13-27-20;1-2-4-5-3-1;/h7-9,19-20,24-27H,10-16,28H2,1-6H3;1-5H;/q2*-1;+2 |
| InChIKey | MWCLUSBJFYEHTA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|