C20H36N4S — CID 176949906
4-[2,3-dimethyl-3-(1,4,7-triazonan-2-yl)butan-2-yl]-N-methylaniline;methanethione (PubChem CID 176949906) has the molecular formula C20H36N4S and a molecular weight of 364.60 g/mol. Its IUPAC name is 4-[2,3-dimethyl-3-(1,4,7-triazonan-2-yl)butan-2-yl]-N-methylaniline;methanethione.
| Compound Name | 4-[2,3-dimethyl-3-(1,4,7-triazonan-2-yl)butan-2-yl]-N-methylaniline;methanethione |
|---|---|
| PubChem CID | 176949906 |
| Molecular Formula | C20H36N4S |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.27 |
| IUPAC Name | 4-[2,3-dimethyl-3-(1,4,7-triazonan-2-yl)butan-2-yl]-N-methylaniline;methanethione |
| SMILES | C=S.CNc1ccc(C(C)(C)C(C)(C)C2CNCCNCCN2)cc1 |
| InChI | InChI=1S/C19H34N4.CH2S/c1-18(2,15-6-8-16(20-5)9-7-15)19(3,4)17-14-22-11-10-21-12-13-23-17;1-2/h6-9,17,20-23H,10-14H2,1-5H3;1H2 |
| InChIKey | KOIDSBKWHBDCRX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|