C11H16N2OS — CID 71251094
N-methyl-4-(1-oxo-1,4-thiazinan-2-yl)aniline (PubChem CID 71251094) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is N-methyl-4-(1-oxo-1,4-thiazinan-2-yl)aniline.
| Compound Name | N-methyl-4-(1-oxo-1,4-thiazinan-2-yl)aniline |
|---|---|
| PubChem CID | 71251094 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | N-methyl-4-(1-oxo-1,4-thiazinan-2-yl)aniline |
| SMILES | CNc1ccc(C2CNCCS2=O)cc1 |
| InChI | InChI=1S/C11H16N2OS/c1-12-10-4-2-9(3-5-10)11-8-13-6-7-15(11)14/h2-5,11-13H,6-8H2,1H3 |
| InChIKey | TVWXAQQBSJSCOH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |