C12H17NOS — CID 82473239
2-(2,5-dimethylphenyl)-1,4-thiazinane 1-oxide (PubChem CID 82473239) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-1,4-thiazinane 1-oxide.
| Compound Name | 2-(2,5-dimethylphenyl)-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 82473239 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-1,4-thiazinane 1-oxide |
| SMILES | Cc1ccc(C)c(C2CNCCS2=O)c1 |
| InChI | InChI=1S/C12H17NOS/c1-9-3-4-10(2)11(7-9)12-8-13-5-6-15(12)14/h3-4,7,12-13H,5-6,8H2,1-2H3 |
| InChIKey | HRFCEXVLZXXZQN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |