C10H8F3NO4 — CID 140668861
(2,2,2-trifluoroacetyl) 5-ethyl-2-oxo-1H-pyridine-3-carboxylate (PubChem CID 140668861) has the molecular formula C10H8F3NO4 and a molecular weight of 263.17 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 5-ethyl-2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 5-ethyl-2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 140668861 |
| Molecular Formula | C10H8F3NO4 |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 5-ethyl-2-oxo-1H-pyridine-3-carboxylate |
| SMILES | CCc1c[nH]c(=O)c(C(=O)OC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8F3NO4/c1-2-5-3-6(7(15)14-4-5)8(16)18-9(17)10(11,12)13/h3-4H,2H2,1H3,(H,14,15) |
| InChIKey | GZQKPSLEFKVGKJ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|