C20H22IO4- — CID 140670155
2-[4-[4-(2-carboxypropan-2-yl)phenyl]iodanuidylphenyl]-2-methylpropanoic acid (PubChem CID 140670155) has the molecular formula C20H22IO4- and a molecular weight of 453.30 g/mol. Its IUPAC name is 2-[4-[4-(2-carboxypropan-2-yl)phenyl]iodanuidylphenyl]-2-methylpropanoic acid.
| Compound Name | 2-[4-[4-(2-carboxypropan-2-yl)phenyl]iodanuidylphenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 140670155 |
| Molecular Formula | C20H22IO4- |
| Molecular Weight | 453.30 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 2-[4-[4-(2-carboxypropan-2-yl)phenyl]iodanuidylphenyl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)c1ccc([I-]c2ccc(C(C)(C)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H22IO4/c1-19(2,17(22)23)13-5-9-15(10-6-13)21-16-11-7-14(8-12-16)20(3,4)18(24)25/h5-12H,1-4H3,(H,22,23)(H,24,25)/q-1 |
| InChIKey | HBTOWBXWEDYEPG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.30 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|