C21H17F3N4O3 — CID 140671075
N-[3-(2-benzamido-4-pyridinyl)-1,1,1-trifluoropropan-2-yl]oxypyridine-3-carboxamide (PubChem CID 140671075) has the molecular formula C21H17F3N4O3 and a molecular weight of 430.39 g/mol. Its IUPAC name is N-[3-(2-benzamido-4-pyridinyl)-1,1,1-trifluoropropan-2-yl]oxypyridine-3-carboxamide.
| Compound Name | N-[3-(2-benzamido-4-pyridinyl)-1,1,1-trifluoropropan-2-yl]oxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 140671075 |
| Molecular Formula | C21H17F3N4O3 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | N-[3-(2-benzamido-4-pyridinyl)-1,1,1-trifluoropropan-2-yl]oxypyridine-3-carboxamide |
| SMILES | O=C(NOC(Cc1ccnc(NC(=O)c2ccccc2)c1)C(F)(F)F)c1cccnc1 |
| InChI | InChI=1S/C21H17F3N4O3/c22-21(23,24)17(31-28-20(30)16-7-4-9-25-13-16)11-14-8-10-26-18(12-14)27-19(29)15-5-2-1-3-6-15/h1-10,12-13,17H,11H2,(H,28,30)(H,26,27,29) |
| InChIKey | LQIHZNVSNWVCEA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|