C16H20F3NO5 — CID 140671161
[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 2-[4-(trifluoromethoxy)phenyl]acetate (PubChem CID 140671161) has the molecular formula C16H20F3NO5 and a molecular weight of 363.33 g/mol. Its IUPAC name is [ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 2-[4-(trifluoromethoxy)phenyl]acetate.
| Compound Name | [ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 2-[4-(trifluoromethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 140671161 |
| Molecular Formula | C16H20F3NO5 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | [ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 2-[4-(trifluoromethoxy)phenyl]acetate |
| SMILES | CCN(OC(=O)Cc1ccc(OC(F)(F)F)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H20F3NO5/c1-5-20(14(22)24-15(2,3)4)25-13(21)10-11-6-8-12(9-7-11)23-16(17,18)19/h6-9H,5,10H2,1-4H3 |
| InChIKey | MDLPRUBWKQFDCA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|