C18H13F2O6S- — CID 140673030
2,6-diacetyl-4-(4-ethenylphenoxy)-3,5-difluorobenzenesulfonate (PubChem CID 140673030) has the molecular formula C18H13F2O6S- and a molecular weight of 395.36 g/mol. Its IUPAC name is 2,6-diacetyl-4-(4-ethenylphenoxy)-3,5-difluorobenzenesulfonate.
| Compound Name | 2,6-diacetyl-4-(4-ethenylphenoxy)-3,5-difluorobenzenesulfonate |
|---|---|
| PubChem CID | 140673030 |
| Molecular Formula | C18H13F2O6S- |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 2,6-diacetyl-4-(4-ethenylphenoxy)-3,5-difluorobenzenesulfonate |
| SMILES | C=Cc1ccc(Oc2c(F)c(C(C)=O)c(S(=O)(=O)[O-])c(C(C)=O)c2F)cc1 |
| InChI | InChI=1S/C18H14F2O6S/c1-4-11-5-7-12(8-6-11)26-17-15(19)13(9(2)21)18(27(23,24)25)14(10(3)22)16(17)20/h4-8H,1H2,2-3H3,(H,23,24,25)/p-1 |
| InChIKey | SSZSUULFLLFAPP-UHFFFAOYSA-M |
| XLogP | 3.71 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|