C18H30ClFN4OS — CID 140674755
N-[N-(3-chlorocyclohexyl)-N'-(4-fluorocyclohexyl)carbamimidoyl]-2-methyl-1,3-thiazolidine-4-carboxamide (PubChem CID 140674755) has the molecular formula C18H30ClFN4OS and a molecular weight of 404.98 g/mol. Its IUPAC name is N-[N-(3-chlorocyclohexyl)-N'-(4-fluorocyclohexyl)carbamimidoyl]-2-methyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[N-(3-chlorocyclohexyl)-N'-(4-fluorocyclohexyl)carbamimidoyl]-2-methyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 140674755 |
| Molecular Formula | C18H30ClFN4OS |
| Molecular Weight | 404.98 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-[N-(3-chlorocyclohexyl)-N'-(4-fluorocyclohexyl)carbamimidoyl]-2-methyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CC1NC(C(=O)N/C(=N\C2CCC(F)CC2)NC2CCCC(Cl)C2)CS1 |
| InChI | InChI=1S/C18H30ClFN4OS/c1-11-21-16(10-26-11)17(25)24-18(22-14-7-5-13(20)6-8-14)23-15-4-2-3-12(19)9-15/h11-16,21H,2-10H2,1H3,(H2,22,23,24,25) |
| InChIKey | MYXXOZJBFAKBDK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.98 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|