C23H38Cl2FN5O — CID 140747100
3-chloro-N-[(Z)-N-(3-chloro-5-fluorocyclohexyl)-N'-(2-cyclohexylpyrazolidin-3-yl)carbamimidoyl]cyclohexane-1-carboxamide (PubChem CID 140747100) has the molecular formula C23H38Cl2FN5O and a molecular weight of 490.50 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-N-(3-chloro-5-fluorocyclohexyl)-N'-(2-cyclohexylpyrazolidin-3-yl)carbamimidoyl]cyclohexane-1-carboxamide.
| Compound Name | 3-chloro-N-[(Z)-N-(3-chloro-5-fluorocyclohexyl)-N'-(2-cyclohexylpyrazolidin-3-yl)carbamimidoyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140747100 |
| Molecular Formula | C23H38Cl2FN5O |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 3-chloro-N-[(Z)-N-(3-chloro-5-fluorocyclohexyl)-N'-(2-cyclohexylpyrazolidin-3-yl)carbamimidoyl]cyclohexane-1-carboxamide |
| SMILES | O=C(N/C(=N\C1CCNN1C1CCCCC1)NC1CC(F)CC(Cl)C1)C1CCCC(Cl)C1 |
| InChI | InChI=1S/C23H38Cl2FN5O/c24-16-6-4-5-15(11-16)22(32)30-23(28-19-13-17(25)12-18(26)14-19)29-21-9-10-27-31(21)20-7-2-1-3-8-20/h15-21,27H,1-14H2,(H2,28,29,30,32) |
| InChIKey | JQJKKWCJNHZZFD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|