C19H28ClF6N5O — CID 140747124
N-[(E)-N-(3-chloro-5-fluorocyclohexyl)-N'-[4-methyl-5-(trifluoromethyl)pyrazolidin-3-yl]carbamimidoyl]-3,4-difluorocyclohexane-1-carboxamide (PubChem CID 140747124) has the molecular formula C19H28ClF6N5O and a molecular weight of 491.91 g/mol. Its IUPAC name is N-[(E)-N-(3-chloro-5-fluorocyclohexyl)-N'-[4-methyl-5-(trifluoromethyl)pyrazolidin-3-yl]carbamimidoyl]-3,4-difluorocyclohexane-1-carboxamide.
| Compound Name | N-[(E)-N-(3-chloro-5-fluorocyclohexyl)-N'-[4-methyl-5-(trifluoromethyl)pyrazolidin-3-yl]carbamimidoyl]-3,4-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140747124 |
| Molecular Formula | C19H28ClF6N5O |
| Molecular Weight | 491.91 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | N-[(E)-N-(3-chloro-5-fluorocyclohexyl)-N'-[4-methyl-5-(trifluoromethyl)pyrazolidin-3-yl]carbamimidoyl]-3,4-difluorocyclohexane-1-carboxamide |
| SMILES | CC1C(/N=C(/NC(=O)C2CCC(F)C(F)C2)NC2CC(F)CC(Cl)C2)NNC1C(F)(F)F |
| InChI | InChI=1S/C19H28ClF6N5O/c1-8-15(19(24,25)26)30-31-16(8)28-18(27-12-6-10(20)5-11(21)7-12)29-17(32)9-2-3-13(22)14(23)4-9/h8-16,30-31H,2-7H2,1H3,(H2,27,28,29,32) |
| InChIKey | GVQATILESXINEQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 77.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.91 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|