C21H35ClF3N5O — CID 140623130
4-chloro-N-[N-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]-N'-(2-methylpropyl)carbamimidoyl]-3-fluorocyclohexane-1-carboxamide (PubChem CID 140623130) has the molecular formula C21H35ClF3N5O and a molecular weight of 465.99 g/mol. Its IUPAC name is 4-chloro-N-[N-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]-N'-(2-methylpropyl)carbamimidoyl]-3-fluorocyclohexane-1-carboxamide.
| Compound Name | 4-chloro-N-[N-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]-N'-(2-methylpropyl)carbamimidoyl]-3-fluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140623130 |
| Molecular Formula | C21H35ClF3N5O |
| Molecular Weight | 465.99 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | 4-chloro-N-[N-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]-N'-(2-methylpropyl)carbamimidoyl]-3-fluorocyclohexane-1-carboxamide |
| SMILES | CC(C)C/N=C(\NC(=O)C1CCC(Cl)C(F)C1)NC1CC(C2CC(F)CC(F)C2)NN1 |
| InChI | InChI=1S/C21H35ClF3N5O/c1-11(2)10-26-21(28-20(31)12-3-4-16(22)17(25)7-12)27-19-9-18(29-30-19)13-5-14(23)8-15(24)6-13/h11-19,29-30H,3-10H2,1-2H3,(H2,26,27,28,31) |
| InChIKey | QXNFGRITHLJKIB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 77.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.99 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|