C24H42F3N5O2 — CID 140623302
3,4-difluoro-N-[N-[5-(3-fluoro-4-methylcyclohexyl)pyrazolidin-3-yl]-N'-(3-propan-2-yloxypropyl)carbamimidoyl]cyclohexane-1-carboxamide (PubChem CID 140623302) has the molecular formula C24H42F3N5O2 and a molecular weight of 489.63 g/mol. Its IUPAC name is 3,4-difluoro-N-[N-[5-(3-fluoro-4-methylcyclohexyl)pyrazolidin-3-yl]-N'-(3-propan-2-yloxypropyl)carbamimidoyl]cyclohexane-1-carboxamide.
| Compound Name | 3,4-difluoro-N-[N-[5-(3-fluoro-4-methylcyclohexyl)pyrazolidin-3-yl]-N'-(3-propan-2-yloxypropyl)carbamimidoyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140623302 |
| Molecular Formula | C24H42F3N5O2 |
| Molecular Weight | 489.63 g/mol |
| Exact Mass | 489.33 |
| IUPAC Name | 3,4-difluoro-N-[N-[5-(3-fluoro-4-methylcyclohexyl)pyrazolidin-3-yl]-N'-(3-propan-2-yloxypropyl)carbamimidoyl]cyclohexane-1-carboxamide |
| SMILES | CC(C)OCCC/N=C(\NC(=O)C1CCC(F)C(F)C1)NC1CC(C2CCC(C)C(F)C2)NN1 |
| InChI | InChI=1S/C24H42F3N5O2/c1-14(2)34-10-4-9-28-24(30-23(33)17-7-8-18(25)20(27)12-17)29-22-13-21(31-32-22)16-6-5-15(3)19(26)11-16/h14-22,31-32H,4-13H2,1-3H3,(H2,28,29,30,33) |
| InChIKey | QTDBEBKPGNJYNR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.63 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|