C19H32F3N5O — CID 140675305
N-[(E)-N-tert-butyl-N'-(4-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl)carbamimidoyl]-3,4-difluorocyclohexane-1-carboxamide (PubChem CID 140675305) has the molecular formula C19H32F3N5O and a molecular weight of 403.49 g/mol. Its IUPAC name is N-[(E)-N-tert-butyl-N'-(4-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl)carbamimidoyl]-3,4-difluorocyclohexane-1-carboxamide.
| Compound Name | N-[(E)-N-tert-butyl-N'-(4-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl)carbamimidoyl]-3,4-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140675305 |
| Molecular Formula | C19H32F3N5O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | N-[(E)-N-tert-butyl-N'-(4-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl)carbamimidoyl]-3,4-difluorocyclohexane-1-carboxamide |
| SMILES | CC(C)(C)N/C(=N\C1NNC2CCCC(F)C21)NC(=O)C1CCC(F)C(F)C1 |
| InChI | InChI=1S/C19H32F3N5O/c1-19(2,3)25-18(24-17(28)10-7-8-11(20)13(22)9-10)23-16-15-12(21)5-4-6-14(15)26-27-16/h10-16,26-27H,4-9H2,1-3H3,(H2,23,24,25,28) |
| InChIKey | IFDZWEUDMSAOKK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 77.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|