C19H34FN5O2 — CID 140675294
N-[(E)-N-tert-butyl-N'-(6-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl)carbamimidoyl]-4-hydroxycyclohexane-1-carboxamide (PubChem CID 140675294) has the molecular formula C19H34FN5O2 and a molecular weight of 383.51 g/mol. Its IUPAC name is N-[(E)-N-tert-butyl-N'-(6-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl)carbamimidoyl]-4-hydroxycyclohexane-1-carboxamide.
| Compound Name | N-[(E)-N-tert-butyl-N'-(6-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl)carbamimidoyl]-4-hydroxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140675294 |
| Molecular Formula | C19H34FN5O2 |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.27 |
| IUPAC Name | N-[(E)-N-tert-butyl-N'-(6-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl)carbamimidoyl]-4-hydroxycyclohexane-1-carboxamide |
| SMILES | CC(C)(C)N/C(=N\C1NNC2CC(F)CCC21)NC(=O)C1CCC(O)CC1 |
| InChI | InChI=1S/C19H34FN5O2/c1-19(2,3)23-18(22-17(27)11-4-7-13(26)8-5-11)21-16-14-9-6-12(20)10-15(14)24-25-16/h11-16,24-26H,4-10H2,1-3H3,(H2,21,22,23,27) |
| InChIKey | YZHQSNUQGCSYER-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|