C23H44ClN7O — CID 140674781
5-tert-butyl-N-[(E)-N-tert-butyl-N'-[5-(4-chlorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-2-methylpyrazolidine-3-carboxamide (PubChem CID 140674781) has the molecular formula C23H44ClN7O and a molecular weight of 470.11 g/mol. Its IUPAC name is 5-tert-butyl-N-[(E)-N-tert-butyl-N'-[5-(4-chlorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-2-methylpyrazolidine-3-carboxamide.
| Compound Name | 5-tert-butyl-N-[(E)-N-tert-butyl-N'-[5-(4-chlorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-2-methylpyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 140674781 |
| Molecular Formula | C23H44ClN7O |
| Molecular Weight | 470.11 g/mol |
| Exact Mass | 469.33 |
| IUPAC Name | 5-tert-butyl-N-[(E)-N-tert-butyl-N'-[5-(4-chlorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-2-methylpyrazolidine-3-carboxamide |
| SMILES | CN1NC(C(C)(C)C)CC1C(=O)N/C(=N/C1CC(C2CCC(Cl)CC2)NN1)NC(C)(C)C |
| InChI | InChI=1S/C23H44ClN7O/c1-22(2,3)18-13-17(31(7)30-18)20(32)26-21(27-23(4,5)6)25-19-12-16(28-29-19)14-8-10-15(24)11-9-14/h14-19,28-30H,8-13H2,1-7H3,(H2,25,26,27,32) |
| InChIKey | BUFYMVOKIZMERD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 92.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.11 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|