C22H40FN5O3S — CID 140623194
N-[(E)-N-tert-butyl-N'-[5-(4-fluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-4-methylsulfonylcyclohexane-1-carboxamide (PubChem CID 140623194) has the molecular formula C22H40FN5O3S and a molecular weight of 473.66 g/mol. Its IUPAC name is N-[(E)-N-tert-butyl-N'-[5-(4-fluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-4-methylsulfonylcyclohexane-1-carboxamide.
| Compound Name | N-[(E)-N-tert-butyl-N'-[5-(4-fluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-4-methylsulfonylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140623194 |
| Molecular Formula | C22H40FN5O3S |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | N-[(E)-N-tert-butyl-N'-[5-(4-fluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-4-methylsulfonylcyclohexane-1-carboxamide |
| SMILES | CC(C)(C)N/C(=N\C1CC(C2CCC(F)CC2)NN1)NC(=O)C1CCC(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C22H40FN5O3S/c1-22(2,3)26-21(25-20(29)15-7-11-17(12-8-15)32(4,30)31)24-19-13-18(27-28-19)14-5-9-16(23)10-6-14/h14-19,27-28H,5-13H2,1-4H3,(H2,24,25,26,29) |
| InChIKey | XZUFVUGPJMWHBC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 111.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|