C22H38F3N5O2 — CID 140623252
N-[(Z)-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]-N-[(2S)-1-ethoxypropan-2-yl]carbamimidoyl]-4-fluorocyclohexane-1-carboxamide (PubChem CID 140623252) has the molecular formula C22H38F3N5O2 and a molecular weight of 461.57 g/mol. Its IUPAC name is N-[(Z)-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]-N-[(2S)-1-ethoxypropan-2-yl]carbamimidoyl]-4-fluorocyclohexane-1-carboxamide.
| Compound Name | N-[(Z)-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]-N-[(2S)-1-ethoxypropan-2-yl]carbamimidoyl]-4-fluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140623252 |
| Molecular Formula | C22H38F3N5O2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | N-[(Z)-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]-N-[(2S)-1-ethoxypropan-2-yl]carbamimidoyl]-4-fluorocyclohexane-1-carboxamide |
| SMILES | CCOC[C@H](C)N/C(=N/C1CC(C2CC(F)CC(F)C2)NN1)NC(=O)C1CCC(F)CC1 |
| InChI | InChI=1S/C22H38F3N5O2/c1-3-32-12-13(2)26-22(28-21(31)14-4-6-16(23)7-5-14)27-20-11-19(29-30-20)15-8-17(24)10-18(25)9-15/h13-20,29-30H,3-12H2,1-2H3,(H2,26,27,28,31)/t13-,14?,15?,16?,17?,18?,19?,20?/m0/s1 |
| InChIKey | XBOLPTPHAQLXMC-ZKPSGEDESA-N |
| XLogP | 2.67 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|