C21H35ClF3N5O2 — CID 140623220
4-chloro-N-[(E)-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]-N-[(2S)-1-methoxypropan-2-yl]carbamimidoyl]-3-fluorocyclohexane-1-carboxamide (PubChem CID 140623220) has the molecular formula C21H35ClF3N5O2 and a molecular weight of 481.99 g/mol. Its IUPAC name is 4-chloro-N-[(E)-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]-N-[(2S)-1-methoxypropan-2-yl]carbamimidoyl]-3-fluorocyclohexane-1-carboxamide.
| Compound Name | 4-chloro-N-[(E)-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]-N-[(2S)-1-methoxypropan-2-yl]carbamimidoyl]-3-fluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140623220 |
| Molecular Formula | C21H35ClF3N5O2 |
| Molecular Weight | 481.99 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 4-chloro-N-[(E)-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]-N-[(2S)-1-methoxypropan-2-yl]carbamimidoyl]-3-fluorocyclohexane-1-carboxamide |
| SMILES | COC[C@H](C)N/C(=N\C1CC(C2CC(F)CC(F)C2)NN1)NC(=O)C1CCC(Cl)C(F)C1 |
| InChI | InChI=1S/C21H35ClF3N5O2/c1-11(10-32-2)26-21(28-20(31)12-3-4-16(22)17(25)7-12)27-19-9-18(29-30-19)13-5-14(23)8-15(24)6-13/h11-19,29-30H,3-10H2,1-2H3,(H2,26,27,28,31)/t11-,12?,13?,14?,15?,16?,17?,18?,19?/m0/s1 |
| InChIKey | UMDJEBHZCZZPFX-QYSDGCHISA-N |
| XLogP | 2.50 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.99 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|