C22H39ClFN5O2 — CID 140623270
4-chloro-N-[(Z)-N-[(2S)-1-ethoxypropan-2-yl]-N'-[5-(4-fluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]cyclohexane-1-carboxamide (PubChem CID 140623270) has the molecular formula C22H39ClFN5O2 and a molecular weight of 460.04 g/mol. Its IUPAC name is 4-chloro-N-[(Z)-N-[(2S)-1-ethoxypropan-2-yl]-N'-[5-(4-fluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]cyclohexane-1-carboxamide.
| Compound Name | 4-chloro-N-[(Z)-N-[(2S)-1-ethoxypropan-2-yl]-N'-[5-(4-fluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140623270 |
| Molecular Formula | C22H39ClFN5O2 |
| Molecular Weight | 460.04 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | 4-chloro-N-[(Z)-N-[(2S)-1-ethoxypropan-2-yl]-N'-[5-(4-fluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]cyclohexane-1-carboxamide |
| SMILES | CCOC[C@H](C)N/C(=N/C1CC(C2CCC(F)CC2)NN1)NC(=O)C1CCC(Cl)CC1 |
| InChI | InChI=1S/C22H39ClFN5O2/c1-3-31-13-14(2)25-22(27-21(30)16-4-8-17(23)9-5-16)26-20-12-19(28-29-20)15-6-10-18(24)11-7-15/h14-20,28-29H,3-13H2,1-2H3,(H2,25,26,27,30)/t14-,15?,16?,17?,18?,19?,20?/m0/s1 |
| InChIKey | GUYDHPXBVGEIHN-KYNCDNKXSA-N |
| XLogP | 2.99 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.04 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|