C22H38F3N5O — CID 140623213
N-[(E)-N-butan-2-yl-N'-[5-(3-fluoro-4-methylcyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-3,4-difluorocyclohexane-1-carboxamide (PubChem CID 140623213) has the molecular formula C22H38F3N5O and a molecular weight of 445.57 g/mol. Its IUPAC name is N-[(E)-N-butan-2-yl-N'-[5-(3-fluoro-4-methylcyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-3,4-difluorocyclohexane-1-carboxamide.
| Compound Name | N-[(E)-N-butan-2-yl-N'-[5-(3-fluoro-4-methylcyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-3,4-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140623213 |
| Molecular Formula | C22H38F3N5O |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.30 |
| IUPAC Name | N-[(E)-N-butan-2-yl-N'-[5-(3-fluoro-4-methylcyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-3,4-difluorocyclohexane-1-carboxamide |
| SMILES | CCC(C)N/C(=N\C1CC(C2CCC(C)C(F)C2)NN1)NC(=O)C1CCC(F)C(F)C1 |
| InChI | InChI=1S/C22H38F3N5O/c1-4-13(3)26-22(28-21(31)15-7-8-16(23)18(25)10-15)27-20-11-19(29-30-20)14-6-5-12(2)17(24)9-14/h12-20,29-30H,4-11H2,1-3H3,(H2,26,27,28,31) |
| InChIKey | VVBNQWKUMYJANI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 77.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|