C21H34F5N5O — CID 140623193
N-[(E)-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]-N-propan-2-ylcarbamimidoyl]-4-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 140623193) has the molecular formula C21H34F5N5O and a molecular weight of 467.53 g/mol. Its IUPAC name is N-[(E)-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]-N-propan-2-ylcarbamimidoyl]-4-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-[(E)-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]-N-propan-2-ylcarbamimidoyl]-4-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140623193 |
| Molecular Formula | C21H34F5N5O |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | N-[(E)-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]-N-propan-2-ylcarbamimidoyl]-4-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CC(C)N/C(=N\C1CC(C2CC(F)CC(F)C2)NN1)NC(=O)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H34F5N5O/c1-11(2)27-20(29-19(32)12-3-5-14(6-4-12)21(24,25)26)28-18-10-17(30-31-18)13-7-15(22)9-16(23)8-13/h11-18,30-31H,3-10H2,1-2H3,(H2,27,28,29,32) |
| InChIKey | AFIPNDCLFRMWJA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 77.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|