C21H35FN6O — CID 140623055
3-cyano-N-[(E)-N'-[5-(4-fluorocyclohexyl)pyrazolidin-3-yl]-N-propan-2-ylcarbamimidoyl]cyclohexane-1-carboxamide (PubChem CID 140623055) has the molecular formula C21H35FN6O and a molecular weight of 406.55 g/mol. Its IUPAC name is 3-cyano-N-[(E)-N'-[5-(4-fluorocyclohexyl)pyrazolidin-3-yl]-N-propan-2-ylcarbamimidoyl]cyclohexane-1-carboxamide.
| Compound Name | 3-cyano-N-[(E)-N'-[5-(4-fluorocyclohexyl)pyrazolidin-3-yl]-N-propan-2-ylcarbamimidoyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140623055 |
| Molecular Formula | C21H35FN6O |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | 3-cyano-N-[(E)-N'-[5-(4-fluorocyclohexyl)pyrazolidin-3-yl]-N-propan-2-ylcarbamimidoyl]cyclohexane-1-carboxamide |
| SMILES | CC(C)N/C(=N\C1CC(C2CCC(F)CC2)NN1)NC(=O)C1CCCC(C#N)C1 |
| InChI | InChI=1S/C21H35FN6O/c1-13(2)24-21(26-20(29)16-5-3-4-14(10-16)12-23)25-19-11-18(27-28-19)15-6-8-17(22)9-7-15/h13-19,27-28H,3-11H2,1-2H3,(H2,24,25,26,29) |
| InChIKey | HWIPYSVASMWUTP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|