C22H39F2N5O2 — CID 140623336
N-[(E)-N-tert-butyl-N'-[5-(4-fluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-2-fluoro-4-methoxycyclohexane-1-carboxamide (PubChem CID 140623336) has the molecular formula C22H39F2N5O2 and a molecular weight of 443.58 g/mol. Its IUPAC name is N-[(E)-N-tert-butyl-N'-[5-(4-fluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-2-fluoro-4-methoxycyclohexane-1-carboxamide.
| Compound Name | N-[(E)-N-tert-butyl-N'-[5-(4-fluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-2-fluoro-4-methoxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140623336 |
| Molecular Formula | C22H39F2N5O2 |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.31 |
| IUPAC Name | N-[(E)-N-tert-butyl-N'-[5-(4-fluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-2-fluoro-4-methoxycyclohexane-1-carboxamide |
| SMILES | COC1CCC(C(=O)N/C(=N/C2CC(C3CCC(F)CC3)NN2)NC(C)(C)C)C(F)C1 |
| InChI | InChI=1S/C22H39F2N5O2/c1-22(2,3)27-21(26-20(30)16-10-9-15(31-4)11-17(16)24)25-19-12-18(28-29-19)13-5-7-14(23)8-6-13/h13-19,28-29H,5-12H2,1-4H3,(H2,25,26,27,30) |
| InChIKey | YSHUXZAGKRMUBX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|