C19H34ClFN6O2 — CID 140674744
N-[(E)-N-tert-butyl-N'-[5-(3-chloro-5-fluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-5-methyl-1,2-oxazolidine-4-carboxamide (PubChem CID 140674744) has the molecular formula C19H34ClFN6O2 and a molecular weight of 432.97 g/mol. Its IUPAC name is N-[(E)-N-tert-butyl-N'-[5-(3-chloro-5-fluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-5-methyl-1,2-oxazolidine-4-carboxamide.
| Compound Name | N-[(E)-N-tert-butyl-N'-[5-(3-chloro-5-fluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-5-methyl-1,2-oxazolidine-4-carboxamide |
|---|---|
| PubChem CID | 140674744 |
| Molecular Formula | C19H34ClFN6O2 |
| Molecular Weight | 432.97 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | N-[(E)-N-tert-butyl-N'-[5-(3-chloro-5-fluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-5-methyl-1,2-oxazolidine-4-carboxamide |
| SMILES | CC1ONCC1C(=O)N/C(=N/C1CC(C2CC(F)CC(Cl)C2)NN1)NC(C)(C)C |
| InChI | InChI=1S/C19H34ClFN6O2/c1-10-14(9-22-29-10)17(28)24-18(25-19(2,3)4)23-16-8-15(26-27-16)11-5-12(20)7-13(21)6-11/h10-16,22,26-27H,5-9H2,1-4H3,(H2,23,24,25,28) |
| InChIKey | JMRDEODESZYKDE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 98.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.97 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|