C22H36F2N6O — CID 140623160
N-[(E)-N-tert-butyl-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-3-cyanocyclohexane-1-carboxamide (PubChem CID 140623160) has the molecular formula C22H36F2N6O and a molecular weight of 438.57 g/mol. Its IUPAC name is N-[(E)-N-tert-butyl-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-3-cyanocyclohexane-1-carboxamide.
| Compound Name | N-[(E)-N-tert-butyl-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-3-cyanocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140623160 |
| Molecular Formula | C22H36F2N6O |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | N-[(E)-N-tert-butyl-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-3-cyanocyclohexane-1-carboxamide |
| SMILES | CC(C)(C)N/C(=N\C1CC(C2CC(F)CC(F)C2)NN1)NC(=O)C1CCCC(C#N)C1 |
| InChI | InChI=1S/C22H36F2N6O/c1-22(2,3)28-21(27-20(31)14-6-4-5-13(7-14)12-25)26-19-11-18(29-30-19)15-8-16(23)10-17(24)9-15/h13-19,29-30H,4-11H2,1-3H3,(H2,26,27,28,31) |
| InChIKey | UXROMWBLPWAIRN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|