C24H39Cl2F2N5O — CID 140623150
4-chloro-N-[N'-[(2-chloro-4-fluorocyclohexyl)methyl]-N-[5-(4-fluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]cyclohexane-1-carboxamide (PubChem CID 140623150) has the molecular formula C24H39Cl2F2N5O and a molecular weight of 522.51 g/mol. Its IUPAC name is 4-chloro-N-[N'-[(2-chloro-4-fluorocyclohexyl)methyl]-N-[5-(4-fluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]cyclohexane-1-carboxamide.
| Compound Name | 4-chloro-N-[N'-[(2-chloro-4-fluorocyclohexyl)methyl]-N-[5-(4-fluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140623150 |
| Molecular Formula | C24H39Cl2F2N5O |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | 4-chloro-N-[N'-[(2-chloro-4-fluorocyclohexyl)methyl]-N-[5-(4-fluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]cyclohexane-1-carboxamide |
| SMILES | O=C(N/C(=N\CC1CCC(F)CC1Cl)NC1CC(C2CCC(F)CC2)NN1)C1CCC(Cl)CC1 |
| InChI | InChI=1S/C24H39Cl2F2N5O/c25-17-6-1-15(2-7-17)23(34)31-24(29-13-16-5-10-19(28)11-20(16)26)30-22-12-21(32-33-22)14-3-8-18(27)9-4-14/h14-22,32-33H,1-13H2,(H2,29,30,31,34) |
| InChIKey | GMCVWXOKPZMPBI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 77.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|