C18H32F2N6O — CID 140675300
N-[(E)-N'-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrazolo[3,4-b]pyridin-3-yl)-N-tert-butylcarbamimidoyl]-3,4-difluorocyclohexane-1-carboxamide (PubChem CID 140675300) has the molecular formula C18H32F2N6O and a molecular weight of 386.49 g/mol. Its IUPAC name is N-[(E)-N'-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrazolo[3,4-b]pyridin-3-yl)-N-tert-butylcarbamimidoyl]-3,4-difluorocyclohexane-1-carboxamide.
| Compound Name | N-[(E)-N'-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrazolo[3,4-b]pyridin-3-yl)-N-tert-butylcarbamimidoyl]-3,4-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140675300 |
| Molecular Formula | C18H32F2N6O |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | N-[(E)-N'-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrazolo[3,4-b]pyridin-3-yl)-N-tert-butylcarbamimidoyl]-3,4-difluorocyclohexane-1-carboxamide |
| SMILES | CC(C)(C)N/C(=N\C1NNC2NCCCC12)NC(=O)C1CCC(F)C(F)C1 |
| InChI | InChI=1S/C18H32F2N6O/c1-18(2,3)24-17(22-15-11-5-4-8-21-14(11)25-26-15)23-16(27)10-6-7-12(19)13(20)9-10/h10-15,21,25-26H,4-9H2,1-3H3,(H2,22,23,24,27) |
| InChIKey | NHVMUZQYXZUGCG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 89.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|