C12H13NO3 — CID 14067800
6,8-dimethoxy-1-methyl-2H-isoquinolin-3-one (PubChem CID 14067800) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 6,8-dimethoxy-1-methyl-2H-isoquinolin-3-one.
| Compound Name | 6,8-dimethoxy-1-methyl-2H-isoquinolin-3-one |
|---|---|
| PubChem CID | 14067800 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 6,8-dimethoxy-1-methyl-2H-isoquinolin-3-one |
| SMILES | COc1cc(OC)c2c(C)[nH]c(=O)cc2c1 |
| InChI | InChI=1S/C12H13NO3/c1-7-12-8(5-11(14)13-7)4-9(15-2)6-10(12)16-3/h4-6H,1-3H3,(H,13,14) |
| InChIKey | AZWXDYGXDBZITB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |