C55H58N2O2 — CID 140678915
4-hydroxy-13-[2-[3-methyl-5-[2-[4-[2-(3-methyl-5-quinolin-2-ylphenyl)ethyl]phenyl]ethyl]phenyl]quinolin-4-yl]tridec-3-en-2-one (PubChem CID 140678915) has the molecular formula C55H58N2O2 and a molecular weight of 779.08 g/mol. Its IUPAC name is 4-hydroxy-13-[2-[3-methyl-5-[2-[4-[2-(3-methyl-5-quinolin-2-ylphenyl)ethyl]phenyl]ethyl]phenyl]quinolin-4-yl]tridec-3-en-2-one.
| Compound Name | 4-hydroxy-13-[2-[3-methyl-5-[2-[4-[2-(3-methyl-5-quinolin-2-ylphenyl)ethyl]phenyl]ethyl]phenyl]quinolin-4-yl]tridec-3-en-2-one |
|---|---|
| PubChem CID | 140678915 |
| Molecular Formula | C55H58N2O2 |
| Molecular Weight | 779.08 g/mol |
| Exact Mass | 778.45 |
| IUPAC Name | 4-hydroxy-13-[2-[3-methyl-5-[2-[4-[2-(3-methyl-5-quinolin-2-ylphenyl)ethyl]phenyl]ethyl]phenyl]quinolin-4-yl]tridec-3-en-2-one |
| SMILES | CC(=O)C=C(O)CCCCCCCCCc1cc(-c2cc(C)cc(CCc3ccc(CCc4cc(C)cc(-c5ccc6ccccc6n5)c4)cc3)c2)nc2ccccc12 |
| InChI | InChI=1S/C55H58N2O2/c1-39-31-44(36-48(33-39)53-30-29-46-15-11-13-19-52(46)56-53)27-25-42-21-23-43(24-22-42)26-28-45-32-40(2)34-49(37-45)55-38-47(51-18-12-14-20-54(51)57-55)16-9-7-5-4-6-8-10-17-50(59)35-41(3)58/h11-15,18-24,29-38,59H,4-10,16-17,25-28H2,1-3H3 |
| InChIKey | YTGZPWMRVVGVJQ-UHFFFAOYSA-N |
| XLogP | 14.00 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.08 |
| LogP ≤ 5 | 14.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|