C48H52N2O6 — CID 140678891
4-hydroxy-7-[2-[[1-[3-[2-[2-[2-(3-isoquinolin-1-yl-5-methylphenyl)ethoxy]ethoxy]ethyl]-5-methylphenyl]isoquinolin-5-yl]methoxy]ethoxy]hept-3-en-2-one (PubChem CID 140678891) has the molecular formula C48H52N2O6 and a molecular weight of 752.95 g/mol. Its IUPAC name is 4-hydroxy-7-[2-[[1-[3-[2-[2-[2-(3-isoquinolin-1-yl-5-methylphenyl)ethoxy]ethoxy]ethyl]-5-methylphenyl]isoquinolin-5-yl]methoxy]ethoxy]hept-3-en-2-one.
| Compound Name | 4-hydroxy-7-[2-[[1-[3-[2-[2-[2-(3-isoquinolin-1-yl-5-methylphenyl)ethoxy]ethoxy]ethyl]-5-methylphenyl]isoquinolin-5-yl]methoxy]ethoxy]hept-3-en-2-one |
|---|---|
| PubChem CID | 140678891 |
| Molecular Formula | C48H52N2O6 |
| Molecular Weight | 752.95 g/mol |
| Exact Mass | 752.38 |
| IUPAC Name | 4-hydroxy-7-[2-[[1-[3-[2-[2-[2-(3-isoquinolin-1-yl-5-methylphenyl)ethoxy]ethoxy]ethyl]-5-methylphenyl]isoquinolin-5-yl]methoxy]ethoxy]hept-3-en-2-one |
| SMILES | CC(=O)C=C(O)CCCOCCOCc1cccc2c(-c3cc(C)cc(CCOCCOCCc4cc(C)cc(-c5nccc6ccccc56)c4)c3)nccc12 |
| InChI | InChI=1S/C48H52N2O6/c1-34-26-37(31-41(28-34)47-45-11-5-4-8-39(45)13-17-49-47)15-20-54-22-23-55-21-16-38-27-35(2)29-42(32-38)48-46-12-6-9-40(44(46)14-18-50-48)33-56-25-24-53-19-7-10-43(52)30-36(3)51/h4-6,8-9,11-14,17-18,26-32,52H,7,10,15-16,19-25,33H2,1-3H3 |
| InChIKey | LWRSVIDGDVSWFV-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.95 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|