C39H46N2O6 — CID 140678872
4-hydroxy-7-[2-[2-[2-[3-[2-[2-[2-(3-pyridin-2-ylphenyl)ethoxy]ethoxy]ethyl]phenyl]-4-pyridinyl]ethoxy]ethoxy]hept-3-en-2-one (PubChem CID 140678872) has the molecular formula C39H46N2O6 and a molecular weight of 638.81 g/mol. Its IUPAC name is 4-hydroxy-7-[2-[2-[2-[3-[2-[2-[2-(3-pyridin-2-ylphenyl)ethoxy]ethoxy]ethyl]phenyl]-4-pyridinyl]ethoxy]ethoxy]hept-3-en-2-one.
| Compound Name | 4-hydroxy-7-[2-[2-[2-[3-[2-[2-[2-(3-pyridin-2-ylphenyl)ethoxy]ethoxy]ethyl]phenyl]-4-pyridinyl]ethoxy]ethoxy]hept-3-en-2-one |
|---|---|
| PubChem CID | 140678872 |
| Molecular Formula | C39H46N2O6 |
| Molecular Weight | 638.81 g/mol |
| Exact Mass | 638.34 |
| IUPAC Name | 4-hydroxy-7-[2-[2-[2-[3-[2-[2-[2-(3-pyridin-2-ylphenyl)ethoxy]ethoxy]ethyl]phenyl]-4-pyridinyl]ethoxy]ethoxy]hept-3-en-2-one |
| SMILES | CC(=O)C=C(O)CCCOCCOCCc1ccnc(-c2cccc(CCOCCOCCc3cccc(-c4ccccn4)c3)c2)c1 |
| InChI | InChI=1S/C39H46N2O6/c1-31(42)27-37(43)11-6-19-44-23-24-47-22-16-34-13-18-41-39(30-34)36-10-5-8-33(29-36)15-21-46-26-25-45-20-14-32-7-4-9-35(28-32)38-12-2-3-17-40-38/h2-5,7-10,12-13,17-18,27-30,43H,6,11,14-16,19-26H2,1H3 |
| InChIKey | BXTRJDVUEZKBPU-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.81 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|