C41H50N2O4 — CID 140678940
4-hydroxy-13-[2-[3-[2-[2-[2-(3-pyridin-2-ylphenyl)ethoxy]ethoxy]ethyl]phenyl]-4-pyridinyl]tridec-3-en-2-one (PubChem CID 140678940) has the molecular formula C41H50N2O4 and a molecular weight of 634.86 g/mol. Its IUPAC name is 4-hydroxy-13-[2-[3-[2-[2-[2-(3-pyridin-2-ylphenyl)ethoxy]ethoxy]ethyl]phenyl]-4-pyridinyl]tridec-3-en-2-one.
| Compound Name | 4-hydroxy-13-[2-[3-[2-[2-[2-(3-pyridin-2-ylphenyl)ethoxy]ethoxy]ethyl]phenyl]-4-pyridinyl]tridec-3-en-2-one |
|---|---|
| PubChem CID | 140678940 |
| Molecular Formula | C41H50N2O4 |
| Molecular Weight | 634.86 g/mol |
| Exact Mass | 634.38 |
| IUPAC Name | 4-hydroxy-13-[2-[3-[2-[2-[2-(3-pyridin-2-ylphenyl)ethoxy]ethoxy]ethyl]phenyl]-4-pyridinyl]tridec-3-en-2-one |
| SMILES | CC(=O)C=C(O)CCCCCCCCCc1ccnc(-c2cccc(CCOCCOCCc3cccc(-c4ccccn4)c3)c2)c1 |
| InChI | InChI=1S/C41H50N2O4/c1-33(44)29-39(45)18-8-6-4-2-3-5-7-13-34-20-24-43-41(32-34)38-17-12-15-36(31-38)22-26-47-28-27-46-25-21-35-14-11-16-37(30-35)40-19-9-10-23-42-40/h9-12,14-17,19-20,23-24,29-32,45H,2-8,13,18,21-22,25-28H2,1H3 |
| InChIKey | IMHGJLQFTZBETK-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.86 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|