C27H31NO4 — CID 140678895
7-[2-[[1-(3,5-dimethylphenyl)isoquinolin-5-yl]methoxy]ethoxy]-4-hydroxyhept-3-en-2-one (PubChem CID 140678895) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is 7-[2-[[1-(3,5-dimethylphenyl)isoquinolin-5-yl]methoxy]ethoxy]-4-hydroxyhept-3-en-2-one.
| Compound Name | 7-[2-[[1-(3,5-dimethylphenyl)isoquinolin-5-yl]methoxy]ethoxy]-4-hydroxyhept-3-en-2-one |
|---|---|
| PubChem CID | 140678895 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 7-[2-[[1-(3,5-dimethylphenyl)isoquinolin-5-yl]methoxy]ethoxy]-4-hydroxyhept-3-en-2-one |
| SMILES | CC(=O)C=C(O)CCCOCCOCc1cccc2c(-c3cc(C)cc(C)c3)nccc12 |
| InChI | InChI=1S/C27H31NO4/c1-19-14-20(2)16-23(15-19)27-26-8-4-6-22(25(26)9-10-28-27)18-32-13-12-31-11-5-7-24(30)17-21(3)29/h4,6,8-10,14-17,30H,5,7,11-13,18H2,1-3H3 |
| InChIKey | UZWINIVWHVZLID-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|