C18H18N2O2 — CID 76809834
4-hydroxy-7-imidazo[2,1-a]isoquinolin-2-ylhept-3-en-2-one (PubChem CID 76809834) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 4-hydroxy-7-imidazo[2,1-a]isoquinolin-2-ylhept-3-en-2-one.
| Compound Name | 4-hydroxy-7-imidazo[2,1-a]isoquinolin-2-ylhept-3-en-2-one |
|---|---|
| PubChem CID | 76809834 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 4-hydroxy-7-imidazo[2,1-a]isoquinolin-2-ylhept-3-en-2-one |
| SMILES | CC(=O)C=C(O)CCCc1cn2ccc3ccccc3c2n1 |
| InChI | InChI=1S/C18H18N2O2/c1-13(21)11-16(22)7-4-6-15-12-20-10-9-14-5-2-3-8-17(14)18(20)19-15/h2-3,5,8-12,22H,4,6-7H2,1H3 |
| InChIKey | WFSQILCOTDFTAX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|